C28H24F4NO+ — CID 147293355
1-(7-fluoro-3-methyldibenzofuran-4-yl)-2-methyl-6-(3,3,3-trifluoro-2,2-dimethylpropyl)isoquinolin-2-ium (PubChem CID 147293355) has the molecular formula C28H24F4NO+ and a molecular weight of 466.50 g/mol. Its IUPAC name is 1-(7-fluoro-3-methyldibenzofuran-4-yl)-2-methyl-6-(3,3,3-trifluoro-2,2-dimethylpropyl)isoquinolin-2-ium.
| Compound Name | 1-(7-fluoro-3-methyldibenzofuran-4-yl)-2-methyl-6-(3,3,3-trifluoro-2,2-dimethylpropyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 147293355 |
| Molecular Formula | C28H24F4NO+ |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 1-(7-fluoro-3-methyldibenzofuran-4-yl)-2-methyl-6-(3,3,3-trifluoro-2,2-dimethylpropyl)isoquinolin-2-ium |
| SMILES | Cc1ccc2c(oc3cc(F)ccc32)c1-c1c2ccc(CC(C)(C)C(F)(F)F)cc2cc[n+]1C |
| InChI | InChI=1S/C28H24F4NO/c1-16-5-8-22-21-10-7-19(29)14-23(21)34-26(22)24(16)25-20-9-6-17(13-18(20)11-12-33(25)4)15-27(2,3)28(30,31)32/h5-14H,15H2,1-4H3/q+1 |
| InChIKey | YYHBCSVXSZTPQE-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|