C19H30O6 — CID 14729598
(2S,3R,4S,5S,6R)-2-methoxy-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane (PubChem CID 14729598) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-2-methoxy-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane.
| Compound Name | (2S,3R,4S,5S,6R)-2-methoxy-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
|---|---|
| PubChem CID | 14729598 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-methoxy-3,4,5-tris(prop-2-enoxy)-6-(prop-2-enoxymethyl)oxane |
| SMILES | C=CCOC[C@H]1O[C@H](OC)[C@H](OCC=C)[C@@H](OCC=C)[C@H]1OCC=C |
| InChI | InChI=1S/C19H30O6/c1-6-10-21-14-15-16(22-11-7-2)17(23-12-8-3)18(24-13-9-4)19(20-5)25-15/h6-9,15-19H,1-4,10-14H2,5H3/t15-,16+,17+,18-,19+/m1/s1 |
| InChIKey | BQYMBCRFFFNQFU-SPOLIRPYSA-N |
| XLogP | 2.27 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|