About 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol
10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol (PubChem CID 147297980) has the molecular formula C18H11BF2O3
and a molecular weight of 324.09 g/mol. Its IUPAC name is 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol.
Molecular Properties
| Compound Name | 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol |
| PubChem CID | 147297980 |
| Molecular Formula | C18H11BF2O3 |
| Molecular Weight | 324.09 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol |
| SMILES | Oc1cccc2c1B(c1c(F)cccc1F)c1c(O)cccc1O2 |
| InChI | InChI=1S/C18H11BF2O3/c20-10-4-1-5-11(21)16(10)19-17-12(22)6-2-8-14(17)24-15-9-3-7-13(23)18(15)19/h1-9,22-23H |
| InChIKey | CVMSLWNMFDJVJI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.09 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol?
The IUPAC name of 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol (CID 147297980) is 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol.
What is the SMILES notation for 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol?
The canonical SMILES for 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol is Oc1cccc2c1B(c1c(F)cccc1F)c1c(O)cccc1O2.
What is the InChIKey of 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol?
The InChIKey is CVMSLWNMFDJVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11BF2O3/c20-10-4-1-5-11(21)16(10)19-17-12(22)6-2-8-14(17)24-15-9-3-7-13(23)18(15)19/h1-9,22-23H.
What are the key properties of 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol?
10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol has a molecular weight of 324.09 g/mol, XLogP of 2.00, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2,6-difluorophenyl)benzo[b][1,4]benzoxaborinine-1,9-diol is sourced from PubChem (CID 147297980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).