About 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene
6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene (PubChem CID 147299245) has the molecular formula C9H6F6O
and a molecular weight of 244.13 g/mol. Its IUPAC name is 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene.
Molecular Properties
| Compound Name | 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene |
| PubChem CID | 147299245 |
| Molecular Formula | C9H6F6O |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)C2CC=CC1O2 |
| InChI | InChI=1S/C9H6F6O/c10-8(11,12)6-4-2-1-3-5(16-4)7(6)9(13,14)15/h1-2,4-5H,3H2 |
| InChIKey | CVSRTDHBGHYWOF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene?
The IUPAC name of 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene (CID 147299245) is 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene.
What is the SMILES notation for 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene?
The canonical SMILES for 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene is FC(F)(F)C1=C(C(F)(F)F)C2CC=CC1O2.
What is the InChIKey of 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene?
The InChIKey is CVSRTDHBGHYWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F6O/c10-8(11,12)6-4-2-1-3-5(16-4)7(6)9(13,14)15/h1-2,4-5H,3H2.
What are the key properties of 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene?
6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene has a molecular weight of 244.13 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(trifluoromethyl)-8-oxabicyclo[3.2.1]octa-2,6-diene is sourced from PubChem (CID 147299245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).