C10H11N3OS — CID 1472997
1-methyl-3-(2-methyl-1,3-benzoxazol-6-yl)thiourea (PubChem CID 1472997) has the molecular formula C10H11N3OS and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-methyl-3-(2-methyl-1,3-benzoxazol-6-yl)thiourea.
| Compound Name | 1-methyl-3-(2-methyl-1,3-benzoxazol-6-yl)thiourea |
|---|---|
| PubChem CID | 1472997 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 1-methyl-3-(2-methyl-1,3-benzoxazol-6-yl)thiourea |
| SMILES | CNC(=S)Nc1ccc2nc(C)oc2c1 |
| InChI | InChI=1S/C10H11N3OS/c1-6-12-8-4-3-7(5-9(8)14-6)13-10(15)11-2/h3-5H,1-2H3,(H2,11,13,15) |
| InChIKey | NINZMKKXHNOYNP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|