C19H26O5S — CID 14730010
(4R,4aR,6S,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine (PubChem CID 14730010) has the molecular formula C19H26O5S and a molecular weight of 366.48 g/mol. Its IUPAC name is (4R,4aR,6S,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine.
| Compound Name | (4R,4aR,6S,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 14730010 |
| Molecular Formula | C19H26O5S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (4R,4aR,6S,7aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-phenylsulfanyl-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxine |
| SMILES | CC1(C)O[C@H]([C@H]2COC(C)(C)O2)[C@@H]2O[C@@H](Sc3ccccc3)C[C@@H]2O1 |
| InChI | InChI=1S/C19H26O5S/c1-18(2)20-11-14(23-18)17-16-13(22-19(3,4)24-17)10-15(21-16)25-12-8-6-5-7-9-12/h5-9,13-17H,10-11H2,1-4H3/t13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | YHDIXYVQYPZKHG-DMRKSPOLSA-N |
| XLogP | 3.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |