About tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate
tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate (PubChem CID 14730281) has the molecular formula C11H17Br2NO2
and a molecular weight of 355.07 g/mol. Its IUPAC name is tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate |
| PubChem CID | 14730281 |
| Molecular Formula | C11H17Br2NO2 |
| Molecular Weight | 355.07 g/mol |
| Exact Mass | 352.96 |
| IUPAC Name | tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C=C(Br)Br |
| InChI | InChI=1S/C11H17Br2NO2/c1-11(2,3)16-10(15)14-6-4-5-8(14)7-9(12)13/h7-8H,4-6H2,1-3H3/t8-/m0/s1 |
| InChIKey | JXIYXIWBJYCVST-QMMMGPOBSA-N |
| XLogP | 4.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.07 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate (CID 14730281) is tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC[C@H]1C=C(Br)Br.
What is the InChIKey of tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate?
The InChIKey is JXIYXIWBJYCVST-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H17Br2NO2/c1-11(2,3)16-10(15)14-6-4-5-8(14)7-9(12)13/h7-8H,4-6H2,1-3H3/t8-/m0/s1.
What are the key properties of tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate?
tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate has a molecular weight of 355.07 g/mol, XLogP of 4.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-(2,2-dibromoethenyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 14730281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).