C28H34N4O6 — CID 147309521
tert-butyl 4-[2-[1-(2,6-dioxopiperidin-3-yl)furo[3,2-f]quinolin-7-yl]oxyethylamino]piperidine-1-carboxylate (PubChem CID 147309521) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is tert-butyl 4-[2-[1-(2,6-dioxopiperidin-3-yl)furo[3,2-f]quinolin-7-yl]oxyethylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[1-(2,6-dioxopiperidin-3-yl)furo[3,2-f]quinolin-7-yl]oxyethylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 147309521 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | tert-butyl 4-[2-[1-(2,6-dioxopiperidin-3-yl)furo[3,2-f]quinolin-7-yl]oxyethylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(NCCOc2ccc3c(ccc4occ(C5CCC(=O)NC5=O)c43)n2)CC1 |
| InChI | InChI=1S/C28H34N4O6/c1-28(2,3)38-27(35)32-13-10-17(11-14-32)29-12-15-36-24-9-5-19-21(30-24)6-7-22-25(19)20(16-37-22)18-4-8-23(33)31-26(18)34/h5-7,9,16-18,29H,4,8,10-15H2,1-3H3,(H,31,33,34) |
| InChIKey | CXRIKGJJOCSPKT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|