About (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide
(2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide (PubChem CID 14731092) has the molecular formula C10H21N3O3
and a molecular weight of 231.30 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide |
| PubChem CID | 14731092 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@H](C(N)=O)[C@@H](C)O |
| InChI | InChI=1S/C10H21N3O3/c1-5(2)4-7(11)10(16)13-8(6(3)14)9(12)15/h5-8,14H,4,11H2,1-3H3,(H2,12,15)(H,13,16)/t6-,7+,8+/m1/s1 |
| InChIKey | LKNDKWLYLJSNMT-CSMHCCOUSA-N |
| XLogP | -1.29 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide?
The IUPAC name of (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide (CID 14731092) is (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide.
What is the SMILES notation for (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide?
The canonical SMILES for (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide is CC(C)C[C@H](N)C(=O)N[C@H](C(N)=O)[C@@H](C)O.
What is the InChIKey of (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide?
The InChIKey is LKNDKWLYLJSNMT-CSMHCCOUSA-N. The full InChI is InChI=1S/C10H21N3O3/c1-5(2)4-7(11)10(16)13-8(6(3)14)9(12)15/h5-8,14H,4,11H2,1-3H3,(H2,12,15)(H,13,16)/t6-,7+,8+/m1/s1.
What are the key properties of (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide?
(2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide has a molecular weight of 231.30 g/mol, XLogP of -1.29, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-[(2S,3R)-1-amino-3-hydroxy-1-oxobutan-2-yl]-4-methylpentanamide is sourced from PubChem (CID 14731092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).