About N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium
N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium (PubChem CID 147315573) has the molecular formula C5H13N2OPY
and a molecular weight of 237.05 g/mol. Its IUPAC name is N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium |
| PubChem CID | 147315573 |
| Molecular Formula | C5H13N2OPY |
| Molecular Weight | 237.05 g/mol |
| Exact Mass | 236.98 |
| IUPAC Name | N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium |
| SMILES | CC(=N[PH](C)=O)N(C)C.[Y] |
| InChI | InChI=1S/C5H13N2OP.Y/c1-5(7(2)3)6-9(4)8;/h9H,1-4H3; |
| InChIKey | BQGFWXPFNLOFDA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.05 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium?
The IUPAC name of N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium (CID 147315573) is N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium.
What is the SMILES notation for N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium?
The canonical SMILES for N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium is CC(=N[PH](C)=O)N(C)C.[Y].
What is the InChIKey of N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium?
The InChIKey is BQGFWXPFNLOFDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N2OP.Y/c1-5(7(2)3)6-9(4)8;/h9H,1-4H3;.
What are the key properties of N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium?
N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium has a molecular weight of 237.05 g/mol, XLogP of 1.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-methylphosphonoylethanimidamide;yttrium is sourced from PubChem (CID 147315573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).