C35H23N3S — CID 147316036
6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-2-phenyl-1,3-benzothiazole (PubChem CID 147316036) has the molecular formula C35H23N3S and a molecular weight of 517.66 g/mol. Its IUPAC name is 6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-2-phenyl-1,3-benzothiazole.
| Compound Name | 6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-2-phenyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 147316036 |
| Molecular Formula | C35H23N3S |
| Molecular Weight | 517.66 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | 6-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-2-phenyl-1,3-benzothiazole |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4ccc5nc(-c6ccccc6)sc5c4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C35H23N3S/c1-4-11-24(12-5-1)31-23-32(37-34(36-31)25-13-6-2-7-14-25)29-18-10-17-27(21-29)28-19-20-30-33(22-28)39-35(38-30)26-15-8-3-9-16-26/h1-23H |
| InChIKey | CYWOKXHACRROCX-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.66 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |