C6H8O2 — CID 14731724
cyclohexa-1,3-diene-1,2-diol (PubChem CID 14731724) has the molecular formula C6H8O2 and a molecular weight of 112.13 g/mol. Its IUPAC name is cyclohexa-1,3-diene-1,2-diol.
| Compound Name | cyclohexa-1,3-diene-1,2-diol |
|---|---|
| PubChem CID | 14731724 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | cyclohexa-1,3-diene-1,2-diol |
| SMILES | OC1=C(O)CCC=C1 |
| InChI | InChI=1S/C6H8O2/c7-5-3-1-2-4-6(5)8/h1,3,7-8H,2,4H2 |
| InChIKey | JNYVPTHMUXMTQC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |