C14H17N3O2 — CID 147324404
4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]morpholine (PubChem CID 147324404) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]morpholine.
| Compound Name | 4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]morpholine |
|---|---|
| PubChem CID | 147324404 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]morpholine |
| SMILES | Cc1ccc(-c2nc(N3CCOCC3)no2)c(C)c1 |
| InChI | InChI=1S/C14H17N3O2/c1-10-3-4-12(11(2)9-10)13-15-14(16-19-13)17-5-7-18-8-6-17/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | DAKXSTMYTJNQAE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |