C20H26N2O2 — CID 147328545
10-methyl-8,16-dioxatricyclo[15.4.0.02,7]henicosa-1(21),2,4,6,17,19-hexaene-3,21-diamine (PubChem CID 147328545) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 10-methyl-8,16-dioxatricyclo[15.4.0.02,7]henicosa-1(21),2,4,6,17,19-hexaene-3,21-diamine.
| Compound Name | 10-methyl-8,16-dioxatricyclo[15.4.0.02,7]henicosa-1(21),2,4,6,17,19-hexaene-3,21-diamine |
|---|---|
| PubChem CID | 147328545 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 10-methyl-8,16-dioxatricyclo[15.4.0.02,7]henicosa-1(21),2,4,6,17,19-hexaene-3,21-diamine |
| SMILES | CC1CCCCCOc2cccc(N)c2-c2c(N)cccc2OC1 |
| InChI | InChI=1S/C20H26N2O2/c1-14-7-3-2-4-12-23-17-10-5-8-15(21)19(17)20-16(22)9-6-11-18(20)24-13-14/h5-6,8-11,14H,2-4,7,12-13,21-22H2,1H3 |
| InChIKey | DBFFNVBGZAANPR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|