About (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine
(E)-N,N'-dimethyl-N'-propylethene-1,2-diamine (PubChem CID 147329171) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine |
| PubChem CID | 147329171 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine |
| SMILES | CCCN(C)/C=C/NC |
| InChI | InChI=1S/C7H16N2/c1-4-6-9(3)7-5-8-2/h5,7-8H,4,6H2,1-3H3/b7-5+ |
| InChIKey | DBICUKLCPXNWQQ-FNORWQNLSA-N |
| XLogP | 1.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine?
The IUPAC name of (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine (CID 147329171) is (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine.
What is the SMILES notation for (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine?
The canonical SMILES for (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine is CCCN(C)/C=C/NC.
What is the InChIKey of (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine?
The InChIKey is DBICUKLCPXNWQQ-FNORWQNLSA-N. The full InChI is InChI=1S/C7H16N2/c1-4-6-9(3)7-5-8-2/h5,7-8H,4,6H2,1-3H3/b7-5+.
What are the key properties of (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine?
(E)-N,N'-dimethyl-N'-propylethene-1,2-diamine has a molecular weight of 128.22 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N'-dimethyl-N'-propylethene-1,2-diamine is sourced from PubChem (CID 147329171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).