About 1,8a-dihydrocinnoline
1,8a-dihydrocinnoline (PubChem CID 147330054) has the molecular formula C8H8N2
and a molecular weight of 132.17 g/mol. Its IUPAC name is 1,8a-dihydrocinnoline.
Molecular Properties
| Compound Name | 1,8a-dihydrocinnoline |
| PubChem CID | 147330054 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 132.17 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 1,8a-dihydrocinnoline |
| SMILES | C1=CC2=CC=NNC2C=C1 |
| InChI | InChI=1S/C8H8N2/c1-2-4-8-7(3-1)5-6-9-10-8/h1-6,8,10H |
| InChIKey | DBMIEHQQNSKSRW-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,8a-dihydrocinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8a-dihydrocinnoline?
The IUPAC name of 1,8a-dihydrocinnoline (CID 147330054) is 1,8a-dihydrocinnoline.
What is the SMILES notation for 1,8a-dihydrocinnoline?
The canonical SMILES for 1,8a-dihydrocinnoline is C1=CC2=CC=NNC2C=C1.
What is the InChIKey of 1,8a-dihydrocinnoline?
The InChIKey is DBMIEHQQNSKSRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2/c1-2-4-8-7(3-1)5-6-9-10-8/h1-6,8,10H.
What are the key properties of 1,8a-dihydrocinnoline?
1,8a-dihydrocinnoline has a molecular weight of 132.17 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8a-dihydrocinnoline is sourced from PubChem (CID 147330054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).