About (3Z,5Z)-2-iminohepta-3,5-dienimidamide
(3Z,5Z)-2-iminohepta-3,5-dienimidamide (PubChem CID 147334801) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is (3Z,5Z)-2-iminohepta-3,5-dienimidamide.
Molecular Properties
| Compound Name | (3Z,5Z)-2-iminohepta-3,5-dienimidamide |
| PubChem CID | 147334801 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (3Z,5Z)-2-iminohepta-3,5-dienimidamide |
| SMILES | [H]/N=C(N)/C(/C=C\C=C/C)=N/[H] |
| InChI | InChI=1S/C7H11N3/c1-2-3-4-5-6(8)7(9)10/h2-5,8H,1H3,(H3,9,10)/b3-2-,5-4-,8-6+ |
| InChIKey | DCITZAGWGIZEIG-FKPAUSHJSA-N |
| XLogP | 1.07 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-2-iminohepta-3,5-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-2-iminohepta-3,5-dienimidamide?
The IUPAC name of (3Z,5Z)-2-iminohepta-3,5-dienimidamide (CID 147334801) is (3Z,5Z)-2-iminohepta-3,5-dienimidamide.
What is the SMILES notation for (3Z,5Z)-2-iminohepta-3,5-dienimidamide?
The canonical SMILES for (3Z,5Z)-2-iminohepta-3,5-dienimidamide is [H]/N=C(N)/C(/C=C\C=C/C)=N/[H].
What is the InChIKey of (3Z,5Z)-2-iminohepta-3,5-dienimidamide?
The InChIKey is DCITZAGWGIZEIG-FKPAUSHJSA-N. The full InChI is InChI=1S/C7H11N3/c1-2-3-4-5-6(8)7(9)10/h2-5,8H,1H3,(H3,9,10)/b3-2-,5-4-,8-6+.
What are the key properties of (3Z,5Z)-2-iminohepta-3,5-dienimidamide?
(3Z,5Z)-2-iminohepta-3,5-dienimidamide has a molecular weight of 137.19 g/mol, XLogP of 1.07, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-2-iminohepta-3,5-dienimidamide is sourced from PubChem (CID 147334801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).