C35H54O7 — CID 14733494
[(3R,4R,5R,6R)-4,5-dihydroxy-6-[5-[4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]-2-methylpentoxy]oxan-3-yl] (E)-2-methyl-5-(4-propan-2-ylphenyl)pent-2-enoate (PubChem CID 14733494) has the molecular formula C35H54O7 and a molecular weight of 586.81 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,5-dihydroxy-6-[5-[4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]-2-methylpentoxy]oxan-3-yl] (E)-2-methyl-5-(4-propan-2-ylphenyl)pent-2-enoate.
| Compound Name | [(3R,4R,5R,6R)-4,5-dihydroxy-6-[5-[4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]-2-methylpentoxy]oxan-3-yl] (E)-2-methyl-5-(4-propan-2-ylphenyl)pent-2-enoate |
|---|---|
| PubChem CID | 14733494 |
| Molecular Formula | C35H54O7 |
| Molecular Weight | 586.81 g/mol |
| Exact Mass | 586.39 |
| IUPAC Name | [(3R,4R,5R,6R)-4,5-dihydroxy-6-[5-[4-(2-hydroxypropan-2-yl)cyclohexen-1-yl]-2-methylpentoxy]oxan-3-yl] (E)-2-methyl-5-(4-propan-2-ylphenyl)pent-2-enoate |
| SMILES | C/C(=C\CCc1ccc(C(C)C)cc1)C(=O)O[C@@H]1CO[C@@H](OCC(C)CCCC2=CCC(C(C)(C)O)CC2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C35H54O7/c1-23(2)28-17-13-26(14-18-28)12-8-10-25(4)33(38)42-30-22-41-34(32(37)31(30)36)40-21-24(3)9-7-11-27-15-19-29(20-16-27)35(5,6)39/h10,13-15,17-18,23-24,29-32,34,36-37,39H,7-9,11-12,16,19-22H2,1-6H3/b25-10+/t24?,29?,30-,31+,32-,34-/m1/s1 |
| InChIKey | JTPNAVNBDHZIJG-FAFJIGCWSA-N |
| XLogP | 6.00 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.81 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|