About 3-ethyl-4,5-difluorophenol
3-ethyl-4,5-difluorophenol (PubChem CID 147335111) has the molecular formula C8H8F2O
and a molecular weight of 158.15 g/mol. Its IUPAC name is 3-ethyl-4,5-difluorophenol.
Molecular Properties
| Compound Name | 3-ethyl-4,5-difluorophenol |
| PubChem CID | 147335111 |
| Molecular Formula | C8H8F2O |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 3-ethyl-4,5-difluorophenol |
| SMILES | CCc1cc(O)cc(F)c1F |
| InChI | InChI=1S/C8H8F2O/c1-2-5-3-6(11)4-7(9)8(5)10/h3-4,11H,2H2,1H3 |
| InChIKey | DCKJKWBIAKNFRH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-4,5-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,5-difluorophenol?
The IUPAC name of 3-ethyl-4,5-difluorophenol (CID 147335111) is 3-ethyl-4,5-difluorophenol.
What is the SMILES notation for 3-ethyl-4,5-difluorophenol?
The canonical SMILES for 3-ethyl-4,5-difluorophenol is CCc1cc(O)cc(F)c1F.
What is the InChIKey of 3-ethyl-4,5-difluorophenol?
The InChIKey is DCKJKWBIAKNFRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2O/c1-2-5-3-6(11)4-7(9)8(5)10/h3-4,11H,2H2,1H3.
What are the key properties of 3-ethyl-4,5-difluorophenol?
3-ethyl-4,5-difluorophenol has a molecular weight of 158.15 g/mol, XLogP of 2.23, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,5-difluorophenol is sourced from PubChem (CID 147335111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).