C23H34O6 — CID 14733544
methyl (3R)-5-[(1R,2S,3S,4aS,8aR)-3-acetyloxy-7-hydroxy-1,2,4a-trimethyl-5-methylidene-6-oxo-2,3,4,8a-tetrahydronaphthalen-1-yl]-3-methylpentanoate (PubChem CID 14733544) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is methyl (3R)-5-[(1R,2S,3S,4aS,8aR)-3-acetyloxy-7-hydroxy-1,2,4a-trimethyl-5-methylidene-6-oxo-2,3,4,8a-tetrahydronaphthalen-1-yl]-3-methylpentanoate.
| Compound Name | methyl (3R)-5-[(1R,2S,3S,4aS,8aR)-3-acetyloxy-7-hydroxy-1,2,4a-trimethyl-5-methylidene-6-oxo-2,3,4,8a-tetrahydronaphthalen-1-yl]-3-methylpentanoate |
|---|---|
| PubChem CID | 14733544 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | methyl (3R)-5-[(1R,2S,3S,4aS,8aR)-3-acetyloxy-7-hydroxy-1,2,4a-trimethyl-5-methylidene-6-oxo-2,3,4,8a-tetrahydronaphthalen-1-yl]-3-methylpentanoate |
| SMILES | C=C1C(=O)C(O)=C[C@@H]2[C@@](C)(CC[C@@H](C)CC(=O)OC)[C@H](C)[C@@H](OC(C)=O)C[C@]12C |
| InChI | InChI=1S/C23H34O6/c1-13(10-20(26)28-7)8-9-22(5)14(2)18(29-16(4)24)12-23(6)15(3)21(27)17(25)11-19(22)23/h11,13-14,18-19,25H,3,8-10,12H2,1-2,4-7H3/t13-,14-,18+,19-,22+,23-/m1/s1 |
| InChIKey | TXACPBSBGQDJJQ-BAINDKLWSA-N |
| XLogP | 4.15 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|