About 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine
7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine (PubChem CID 1473367) has the molecular formula C16H8F6N2O
and a molecular weight of 358.24 g/mol. Its IUPAC name is 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine.
Molecular Properties
| Compound Name | 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine |
| PubChem CID | 1473367 |
| Molecular Formula | C16H8F6N2O |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)c2ccc(Oc3ccccc3)nc2n1 |
| InChI | InChI=1S/C16H8F6N2O/c17-15(18,19)11-8-12(16(20,21)22)23-14-10(11)6-7-13(24-14)25-9-4-2-1-3-5-9/h1-8H |
| InChIKey | OUGNNHQMDRPPEQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine?
The IUPAC name of 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine (CID 1473367) is 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine.
What is the SMILES notation for 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine?
The canonical SMILES for 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine is FC(F)(F)c1cc(C(F)(F)F)c2ccc(Oc3ccccc3)nc2n1.
What is the InChIKey of 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine?
The InChIKey is OUGNNHQMDRPPEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8F6N2O/c17-15(18,19)11-8-12(16(20,21)22)23-14-10(11)6-7-13(24-14)25-9-4-2-1-3-5-9/h1-8H.
What are the key properties of 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine?
7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine has a molecular weight of 358.24 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-phenoxy-2,4-bis(trifluoromethyl)-1,8-naphthyridine is sourced from PubChem (CID 1473367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).