C15H26O3 — CID 14733707
(1R,2S,4R,4aR,8aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,8,8a-hexahydronaphthalene-1,2,4-triol (PubChem CID 14733707) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (1R,2S,4R,4aR,8aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,8,8a-hexahydronaphthalene-1,2,4-triol.
| Compound Name | (1R,2S,4R,4aR,8aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,8,8a-hexahydronaphthalene-1,2,4-triol |
|---|---|
| PubChem CID | 14733707 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1R,2S,4R,4aR,8aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,5,8,8a-hexahydronaphthalene-1,2,4-triol |
| SMILES | CC(C)C1=CC[C@@]2(C)[C@H](O)C[C@H](O)[C@](C)(O)[C@@H]2C1 |
| InChI | InChI=1S/C15H26O3/c1-9(2)10-5-6-14(3)11(7-10)15(4,18)13(17)8-12(14)16/h5,9,11-13,16-18H,6-8H2,1-4H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | FSMBJKQQINYARA-UXXRCYHCSA-N |
| XLogP | 1.86 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|