C24H19ClF2N4O3 — CID 147337509
methyl 6-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine-3-carboxylate (PubChem CID 147337509) has the molecular formula C24H19ClF2N4O3 and a molecular weight of 484.89 g/mol. Its IUPAC name is methyl 6-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine-3-carboxylate.
| Compound Name | methyl 6-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 147337509 |
| Molecular Formula | C24H19ClF2N4O3 |
| Molecular Weight | 484.89 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | methyl 6-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc2ccc(-c3cn(C4CCCCO4)nc3-c3cc(Cl)c(F)cc3F)nc2c1 |
| InChI | InChI=1S/C24H19ClF2N4O3/c1-33-24(32)13-8-21-20(28-11-13)6-5-19(29-21)15-12-31(22-4-2-3-7-34-22)30-23(15)14-9-16(25)18(27)10-17(14)26/h5-6,8-12,22H,2-4,7H2,1H3 |
| InChIKey | DCVKFWCZFPSLAO-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.89 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|