C17H30O3Si — CID 147337646
6-[tert-butyl(dimethyl)silyl]oxyundeca-1,10-diene-3,9-dione (PubChem CID 147337646) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxyundeca-1,10-diene-3,9-dione.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxyundeca-1,10-diene-3,9-dione |
|---|---|
| PubChem CID | 147337646 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxyundeca-1,10-diene-3,9-dione |
| SMILES | C=CC(=O)CCC(CCC(=O)C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O3Si/c1-8-14(18)10-12-16(13-11-15(19)9-2)20-21(6,7)17(3,4)5/h8-9,16H,1-2,10-13H2,3-7H3 |
| InChIKey | DCWATSWNYUEBFG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|