C13H20O2 — CID 14734012
(6S)-5,5-dimethyl-6-[(5R)-5-methylcyclopenten-1-yl]oxan-2-one (PubChem CID 14734012) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (6S)-5,5-dimethyl-6-[(5R)-5-methylcyclopenten-1-yl]oxan-2-one.
| Compound Name | (6S)-5,5-dimethyl-6-[(5R)-5-methylcyclopenten-1-yl]oxan-2-one |
|---|---|
| PubChem CID | 14734012 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (6S)-5,5-dimethyl-6-[(5R)-5-methylcyclopenten-1-yl]oxan-2-one |
| SMILES | C[C@@H]1CCC=C1[C@H]1OC(=O)CCC1(C)C |
| InChI | InChI=1S/C13H20O2/c1-9-5-4-6-10(9)12-13(2,3)8-7-11(14)15-12/h6,9,12H,4-5,7-8H2,1-3H3/t9-,12-/m1/s1 |
| InChIKey | YFXBTDOBIALGNL-BXKDBHETSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|