C5H7BO5 — CID 147341077
2-(2-methyl-5-oxo-1,3,2-dioxaborolan-4-yl)acetic acid (PubChem CID 147341077) has the molecular formula C5H7BO5 and a molecular weight of 157.92 g/mol. Its IUPAC name is 2-(2-methyl-5-oxo-1,3,2-dioxaborolan-4-yl)acetic acid.
| Compound Name | 2-(2-methyl-5-oxo-1,3,2-dioxaborolan-4-yl)acetic acid |
|---|---|
| PubChem CID | 147341077 |
| Molecular Formula | C5H7BO5 |
| Molecular Weight | 157.92 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | 2-(2-methyl-5-oxo-1,3,2-dioxaborolan-4-yl)acetic acid |
| SMILES | CB1OC(=O)C(CC(=O)O)O1 |
| InChI | InChI=1S/C5H7BO5/c1-6-10-3(2-4(7)8)5(9)11-6/h3H,2H2,1H3,(H,7,8) |
| InChIKey | DDMQSURIMZJIHL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.92 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|