C32H38Cl2F2N6O4 — CID 147342156
1-[(3S,4R)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[4-(3,3-difluoropyrrolidin-1-yl)butylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]but-3-en-2-one (PubChem CID 147342156) has the molecular formula C32H38Cl2F2N6O4 and a molecular weight of 679.60 g/mol. Its IUPAC name is 1-[(3S,4R)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[4-(3,3-difluoropyrrolidin-1-yl)butylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]but-3-en-2-one.
| Compound Name | 1-[(3S,4R)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[4-(3,3-difluoropyrrolidin-1-yl)butylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 147342156 |
| Molecular Formula | C32H38Cl2F2N6O4 |
| Molecular Weight | 679.60 g/mol |
| Exact Mass | 678.23 |
| IUPAC Name | 1-[(3S,4R)-3-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-[4-(3,3-difluoropyrrolidin-1-yl)butylamino]pyrido[3,4-d]pyrimidin-2-yl]amino]oxan-4-yl]but-3-en-2-one |
| SMILES | C=CC(=O)C[C@H]1CCOC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)nc(NCCCCN3CCC(F)(F)C3)c2n1 |
| InChI | InChI=1S/C32H38Cl2F2N6O4/c1-4-21(43)13-19-7-12-46-17-23(19)40-31-38-16-20-14-22(26-27(33)24(44-2)15-25(45-3)28(26)34)39-30(29(20)41-31)37-9-5-6-10-42-11-8-32(35,36)18-42/h4,14-16,19,23H,1,5-13,17-18H2,2-3H3,(H,37,39)(H,38,40,41)/t19-,23-/m1/s1 |
| InChIKey | DDSFOJKKBQFKIP-AUSIDOKSSA-N |
| XLogP | 6.51 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|