C24H20BrCl2F6NO2 — CID 147345408
4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[(2R)-6,6,6-trifluoro-4-oxohexan-2-yl]benzamide (PubChem CID 147345408) has the molecular formula C24H20BrCl2F6NO2 and a molecular weight of 619.23 g/mol. Its IUPAC name is 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[(2R)-6,6,6-trifluoro-4-oxohexan-2-yl]benzamide.
| Compound Name | 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[(2R)-6,6,6-trifluoro-4-oxohexan-2-yl]benzamide |
|---|---|
| PubChem CID | 147345408 |
| Molecular Formula | C24H20BrCl2F6NO2 |
| Molecular Weight | 619.23 g/mol |
| Exact Mass | 617.00 |
| IUPAC Name | 4-[(E)-3-(4-bromo-3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]-2-methyl-N-[(2R)-6,6,6-trifluoro-4-oxohexan-2-yl]benzamide |
| SMILES | Cc1cc(/C=C/C(c2cc(Cl)c(Br)c(Cl)c2)C(F)(F)F)ccc1C(=O)N[C@H](C)CC(=O)CC(F)(F)F |
| InChI | InChI=1S/C24H20BrCl2F6NO2/c1-12-7-14(3-5-17(12)22(36)34-13(2)8-16(35)11-23(28,29)30)4-6-18(24(31,32)33)15-9-19(26)21(25)20(27)10-15/h3-7,9-10,13,18H,8,11H2,1-2H3,(H,34,36)/b6-4+/t13-,18?/m1/s1 |
| InChIKey | DEIIUTWZVAVFEN-CRBTUMLHSA-N |
| XLogP | 8.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.23 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|