C18H35NO2 — CID 147348593
(E)-6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylhex-4-enamide (PubChem CID 147348593) has the molecular formula C18H35NO2 and a molecular weight of 297.48 g/mol. Its IUPAC name is (E)-6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylhex-4-enamide.
| Compound Name | (E)-6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylhex-4-enamide |
|---|---|
| PubChem CID | 147348593 |
| Molecular Formula | C18H35NO2 |
| Molecular Weight | 297.48 g/mol |
| Exact Mass | 297.27 |
| IUPAC Name | (E)-6-(2,2-dimethylpropoxy)-N-(2,2-dimethylpropyl)-2,2-dimethylhex-4-enamide |
| SMILES | CC(C)(C)CNC(=O)C(C)(C)C/C=C/COCC(C)(C)C |
| InChI | InChI=1S/C18H35NO2/c1-16(2,3)13-19-15(20)18(7,8)11-9-10-12-21-14-17(4,5)6/h9-10H,11-14H2,1-8H3,(H,19,20)/b10-9+ |
| InChIKey | DEXZLFXSECYIKT-MDZDMXLPSA-N |
| XLogP | 4.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|