C17H21NO2 — CID 1473509
1,4-dimethoxy-6,7,8,9,10,11-hexahydrocycloocta[b]quinoline (PubChem CID 1473509) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1,4-dimethoxy-6,7,8,9,10,11-hexahydrocycloocta[b]quinoline.
| Compound Name | 1,4-dimethoxy-6,7,8,9,10,11-hexahydrocycloocta[b]quinoline |
|---|---|
| PubChem CID | 1473509 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1,4-dimethoxy-6,7,8,9,10,11-hexahydrocycloocta[b]quinoline |
| SMILES | COc1ccc(OC)c2nc3c(cc12)CCCCCC3 |
| InChI | InChI=1S/C17H21NO2/c1-19-15-9-10-16(20-2)17-13(15)11-12-7-5-3-4-6-8-14(12)18-17/h9-11H,3-8H2,1-2H3 |
| InChIKey | ODLCWJHFXQSRME-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |