C33H33F7N2O4 — CID 147352242
[(3S,6R)-6-[2-[2-[(3S,4S)-3-amino-4-(3,5-difluorophenyl)-4-(4-fluorophenyl)-2-oxobutyl]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate (PubChem CID 147352242) has the molecular formula C33H33F7N2O4 and a molecular weight of 654.62 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[2-[(3S,4S)-3-amino-4-(3,5-difluorophenyl)-4-(4-fluorophenyl)-2-oxobutyl]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate.
| Compound Name | [(3S,6R)-6-[2-[2-[(3S,4S)-3-amino-4-(3,5-difluorophenyl)-4-(4-fluorophenyl)-2-oxobutyl]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 147352242 |
| Molecular Formula | C33H33F7N2O4 |
| Molecular Weight | 654.62 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | [(3S,6R)-6-[2-[2-[(3S,4S)-3-amino-4-(3,5-difluorophenyl)-4-(4-fluorophenyl)-2-oxobutyl]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl 4,4,4-trifluorobutanoate |
| SMILES | N[C@H](C(=O)Cc1cccc(F)c1CC[C@@H]1CN[C@H](COC(=O)CCC(F)(F)F)CO1)[C@@H](c1ccc(F)cc1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C33H33F7N2O4/c34-22-6-4-19(5-7-22)31(21-12-23(35)15-24(36)13-21)32(41)29(43)14-20-2-1-3-28(37)27(20)9-8-26-16-42-25(17-45-26)18-46-30(44)10-11-33(38,39)40/h1-7,12-13,15,25-26,31-32,42H,8-11,14,16-18,41H2/t25-,26+,31-,32+/m0/s1 |
| InChIKey | DFPYEDDGGYXRAP-MAOWDPDTSA-N |
| XLogP | 5.69 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |