About (Z)-4-imino-N,2-dimethylbut-1-en-1-amine
(Z)-4-imino-N,2-dimethylbut-1-en-1-amine (PubChem CID 147353568) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is (Z)-4-imino-N,2-dimethylbut-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-4-imino-N,2-dimethylbut-1-en-1-amine |
| PubChem CID | 147353568 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (Z)-4-imino-N,2-dimethylbut-1-en-1-amine |
| SMILES | [H]/N=C/C/C(C)=C\NC |
| InChI | InChI=1S/C6H12N2/c1-6(3-4-7)5-8-2/h4-5,7-8H,3H2,1-2H3/b6-5-,7-4+ |
| InChIKey | DFWLFOMLQBWHSQ-IUQJDUBZSA-N |
| XLogP | 1.15 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-imino-N,2-dimethylbut-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-imino-N,2-dimethylbut-1-en-1-amine?
The IUPAC name of (Z)-4-imino-N,2-dimethylbut-1-en-1-amine (CID 147353568) is (Z)-4-imino-N,2-dimethylbut-1-en-1-amine.
What is the SMILES notation for (Z)-4-imino-N,2-dimethylbut-1-en-1-amine?
The canonical SMILES for (Z)-4-imino-N,2-dimethylbut-1-en-1-amine is [H]/N=C/C/C(C)=C\NC.
What is the InChIKey of (Z)-4-imino-N,2-dimethylbut-1-en-1-amine?
The InChIKey is DFWLFOMLQBWHSQ-IUQJDUBZSA-N. The full InChI is InChI=1S/C6H12N2/c1-6(3-4-7)5-8-2/h4-5,7-8H,3H2,1-2H3/b6-5-,7-4+.
What are the key properties of (Z)-4-imino-N,2-dimethylbut-1-en-1-amine?
(Z)-4-imino-N,2-dimethylbut-1-en-1-amine has a molecular weight of 112.18 g/mol, XLogP of 1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-imino-N,2-dimethylbut-1-en-1-amine is sourced from PubChem (CID 147353568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).