C11H11NOS — CID 14735589
2,3,4,9-tetrahydrothiopyrano[2,3-b]indol-3-ol (PubChem CID 14735589) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 2,3,4,9-tetrahydrothiopyrano[2,3-b]indol-3-ol.
| Compound Name | 2,3,4,9-tetrahydrothiopyrano[2,3-b]indol-3-ol |
|---|---|
| PubChem CID | 14735589 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2,3,4,9-tetrahydrothiopyrano[2,3-b]indol-3-ol |
| SMILES | OC1CSc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C11H11NOS/c13-7-5-9-8-3-1-2-4-10(8)12-11(9)14-6-7/h1-4,7,12-13H,5-6H2 |
| InChIKey | AIARBSYBQVXFBE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |