C8H15N3O2S — CID 1473591
3-(2,2-dimethoxyethyl)-4-methyl-5-methylsulfanyl-1,2,4-triazole (PubChem CID 1473591) has the molecular formula C8H15N3O2S and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-(2,2-dimethoxyethyl)-4-methyl-5-methylsulfanyl-1,2,4-triazole.
| Compound Name | 3-(2,2-dimethoxyethyl)-4-methyl-5-methylsulfanyl-1,2,4-triazole |
|---|---|
| PubChem CID | 1473591 |
| Molecular Formula | C8H15N3O2S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 3-(2,2-dimethoxyethyl)-4-methyl-5-methylsulfanyl-1,2,4-triazole |
| SMILES | COC(Cc1nnc(SC)n1C)OC |
| InChI | InChI=1S/C8H15N3O2S/c1-11-6(5-7(12-2)13-3)9-10-8(11)14-4/h7H,5H2,1-4H3 |
| InChIKey | KFGWDSAJGIBXGL-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|