About 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene
7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene (PubChem CID 14735916) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene.
Analyze 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene?
The IUPAC name of 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene (CID 14735916) is 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene.
What is the SMILES notation for 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene?
The canonical SMILES for 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene is C1=CC2C3C=CC=CN3CCN2C=C1.
What is the InChIKey of 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene?
The InChIKey is UMRXUTKNFUKLFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2/c1-3-7-13-9-10-14-8-4-2-6-12(14)11(13)5-1/h1-8,11-12H,9-10H2.
What are the key properties of 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene?
7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene has a molecular weight of 186.26 g/mol, XLogP of 1.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,10-diazatricyclo[8.4.0.02,7]tetradeca-3,5,11,13-tetraene is sourced from PubChem (CID 14735916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).