About 3-bromopyrazin-2-amine
3-bromopyrazin-2-amine (PubChem CID 14735942) has the molecular formula C4H4BrN3
and a molecular weight of 174.00 g/mol. Its IUPAC name is 3-bromopyrazin-2-amine.
Molecular Properties
| Compound Name | 3-bromopyrazin-2-amine |
| PubChem CID | 14735942 |
| Molecular Formula | C4H4BrN3 |
| Molecular Weight | 174.00 g/mol |
| Exact Mass | 172.96 |
| IUPAC Name | 3-bromopyrazin-2-amine |
| SMILES | Nc1nccnc1Br |
| InChI | InChI=1S/C4H4BrN3/c5-3-4(6)8-2-1-7-3/h1-2H,(H2,6,8) |
| InChIKey | BFEUGUAUYFATRV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.00 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromopyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopyrazin-2-amine?
The IUPAC name of 3-bromopyrazin-2-amine (CID 14735942) is 3-bromopyrazin-2-amine.
What is the SMILES notation for 3-bromopyrazin-2-amine?
The canonical SMILES for 3-bromopyrazin-2-amine is Nc1nccnc1Br.
What is the InChIKey of 3-bromopyrazin-2-amine?
The InChIKey is BFEUGUAUYFATRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrN3/c5-3-4(6)8-2-1-7-3/h1-2H,(H2,6,8).
What are the key properties of 3-bromopyrazin-2-amine?
3-bromopyrazin-2-amine has a molecular weight of 174.00 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopyrazin-2-amine is sourced from PubChem (CID 14735942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).