C14H19N7O — CID 147359672
3-[2,6-bis(methylamino)-4-(prop-2-ynylamino)pyrimido[5,4-d]pyrimidin-8-yl]propan-1-ol (PubChem CID 147359672) has the molecular formula C14H19N7O and a molecular weight of 301.35 g/mol. Its IUPAC name is 3-[2,6-bis(methylamino)-4-(prop-2-ynylamino)pyrimido[5,4-d]pyrimidin-8-yl]propan-1-ol.
| Compound Name | 3-[2,6-bis(methylamino)-4-(prop-2-ynylamino)pyrimido[5,4-d]pyrimidin-8-yl]propan-1-ol |
|---|---|
| PubChem CID | 147359672 |
| Molecular Formula | C14H19N7O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-[2,6-bis(methylamino)-4-(prop-2-ynylamino)pyrimido[5,4-d]pyrimidin-8-yl]propan-1-ol |
| SMILES | C#CCNc1nc(NC)nc2c(CCCO)nc(NC)nc12 |
| InChI | InChI=1S/C14H19N7O/c1-4-7-17-12-11-10(19-14(16-3)21-12)9(6-5-8-22)18-13(15-2)20-11/h1,22H,5-8H2,2-3H3,(H,15,18,20)(H2,16,17,19,21) |
| InChIKey | DGZSWTBDSVJZNF-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|