C17H16N2O2 — CID 1473602
ethyl 6-methyl-2-phenylimidazo[1,2-a]pyridine-3-carboxylate (PubChem CID 1473602) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is ethyl 6-methyl-2-phenylimidazo[1,2-a]pyridine-3-carboxylate.
| Compound Name | ethyl 6-methyl-2-phenylimidazo[1,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 1473602 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | ethyl 6-methyl-2-phenylimidazo[1,2-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)nc2ccc(C)cn12 |
| InChI | InChI=1S/C17H16N2O2/c1-3-21-17(20)16-15(13-7-5-4-6-8-13)18-14-10-9-12(2)11-19(14)16/h4-11H,3H2,1-2H3 |
| InChIKey | PGKICPOZCQGAHE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |