C19H22F3NO8 — CID 147361112
methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-amino-4-(trifluoromethyl)phenoxy]-3-methyloxane-2-carboxylate (PubChem CID 147361112) has the molecular formula C19H22F3NO8 and a molecular weight of 449.38 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-amino-4-(trifluoromethyl)phenoxy]-3-methyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-amino-4-(trifluoromethyl)phenoxy]-3-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 147361112 |
| Molecular Formula | C19H22F3NO8 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-4,5-diacetyloxy-6-[2-amino-4-(trifluoromethyl)phenoxy]-3-methyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Oc2ccc(C(F)(F)F)cc2N)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C19H22F3NO8/c1-8-14(28-9(2)24)16(29-10(3)25)18(31-15(8)17(26)27-4)30-13-6-5-11(7-12(13)23)19(20,21)22/h5-8,14-16,18H,23H2,1-4H3/t8-,14-,15-,16+,18+/m0/s1 |
| InChIKey | DHHATYANEQFMFU-YNIDGGHNSA-N |
| XLogP | 2.06 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|