C21H24N6O4S — CID 147361420
4-[6-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-8-oxa-3,5-diazatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-4-yl]-1H-pyrrolo[2,3-c]pyridin-5-amine (PubChem CID 147361420) has the molecular formula C21H24N6O4S and a molecular weight of 456.53 g/mol. Its IUPAC name is 4-[6-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-8-oxa-3,5-diazatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-4-yl]-1H-pyrrolo[2,3-c]pyridin-5-amine.
| Compound Name | 4-[6-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-8-oxa-3,5-diazatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-4-yl]-1H-pyrrolo[2,3-c]pyridin-5-amine |
|---|---|
| PubChem CID | 147361420 |
| Molecular Formula | C21H24N6O4S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 4-[6-[(3R)-3-methylmorpholin-4-yl]-1-methylsulfonyl-8-oxa-3,5-diazatricyclo[7.1.1.02,7]undeca-2(7),3,5-trien-4-yl]-1H-pyrrolo[2,3-c]pyridin-5-amine |
| SMILES | C[C@@H]1COCCN1c1nc(-c2c(N)ncc3[nH]ccc23)nc2c1OC1CC2(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C21H24N6O4S/c1-11-10-30-6-5-27(11)20-16-17(21(32(2,28)29)7-12(8-21)31-16)25-19(26-20)15-13-3-4-23-14(13)9-24-18(15)22/h3-4,9,11-12,23H,5-8,10H2,1-2H3,(H2,22,24)/t11-,12?,21?/m1/s1 |
| InChIKey | DHIOKYYXEHMPFD-JRBJCYRMSA-N |
| XLogP | 1.62 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |