C25H36FN3O5S — CID 147362167
1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-(1-methylpyrrolidin-3-yl)ethyl]sulfonylpentyl]imidazolidine-2,4-dione (PubChem CID 147362167) has the molecular formula C25H36FN3O5S and a molecular weight of 509.64 g/mol. Its IUPAC name is 1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-(1-methylpyrrolidin-3-yl)ethyl]sulfonylpentyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-(1-methylpyrrolidin-3-yl)ethyl]sulfonylpentyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 147362167 |
| Molecular Formula | C25H36FN3O5S |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | 1-[5-[(2R)-2-[3-(cyclopropylmethoxy)-4-fluorophenyl]-2-(1-methylpyrrolidin-3-yl)ethyl]sulfonylpentyl]imidazolidine-2,4-dione |
| SMILES | CN1CCC([C@@H](CS(=O)(=O)CCCCCN2CC(=O)NC2=O)c2ccc(F)c(OCC3CC3)c2)C1 |
| InChI | InChI=1S/C25H36FN3O5S/c1-28-11-9-20(14-28)21(19-7-8-22(26)23(13-19)34-16-18-5-6-18)17-35(32,33)12-4-2-3-10-29-15-24(30)27-25(29)31/h7-8,13,18,20-21H,2-6,9-12,14-17H2,1H3,(H,27,30,31)/t20?,21-/m0/s1 |
| InChIKey | DHMAAUIFUARBAA-LBAQZLPGSA-N |
| XLogP | 2.79 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|