C20H27Cl2N3O — CID 147364645
3-(3,4-dichlorophenyl)imino-1-[[(1R,2S)-2-(pyrrolidin-1-ylmethyl)cyclobutyl]methoxy]but-1-en-1-amine (PubChem CID 147364645) has the molecular formula C20H27Cl2N3O and a molecular weight of 396.36 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)imino-1-[[(1R,2S)-2-(pyrrolidin-1-ylmethyl)cyclobutyl]methoxy]but-1-en-1-amine.
| Compound Name | 3-(3,4-dichlorophenyl)imino-1-[[(1R,2S)-2-(pyrrolidin-1-ylmethyl)cyclobutyl]methoxy]but-1-en-1-amine |
|---|---|
| PubChem CID | 147364645 |
| Molecular Formula | C20H27Cl2N3O |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-(3,4-dichlorophenyl)imino-1-[[(1R,2S)-2-(pyrrolidin-1-ylmethyl)cyclobutyl]methoxy]but-1-en-1-amine |
| SMILES | C/C(C=C(N)OC[C@@H]1CC[C@@H]1CN1CCCC1)=N\c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H27Cl2N3O/c1-14(24-17-6-7-18(21)19(22)11-17)10-20(23)26-13-16-5-4-15(16)12-25-8-2-3-9-25/h6-7,10-11,15-16H,2-5,8-9,12-13,23H2,1H3/b20-10?,24-14+/t15-,16+/m1/s1 |
| InChIKey | XGAQZBMNOHTSDP-LRDLVCQCSA-N |
| XLogP | 5.02 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|