C10H8F6N2S — CID 147364740
[3,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]thiourea (PubChem CID 147364740) has the molecular formula C10H8F6N2S and a molecular weight of 302.24 g/mol. Its IUPAC name is [3,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]thiourea.
| Compound Name | [3,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]thiourea |
|---|---|
| PubChem CID | 147364740 |
| Molecular Formula | C10H8F6N2S |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | [3,6-bis(trifluoromethyl)cyclohepta-1,4,6-trien-1-yl]thiourea |
| SMILES | NC(=S)NC1=CC(C(F)(F)F)C=CC(C(F)(F)F)=C1 |
| InChI | InChI=1S/C10H8F6N2S/c11-9(12,13)5-1-2-6(10(14,15)16)4-7(3-5)18-8(17)19/h1-5H,(H3,17,18,19) |
| InChIKey | DHYICQUBAWYHSY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|