C21H23BN6O8S — CID 147367516
(3R)-3-[[(2R)-2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 147367516) has the molecular formula C21H23BN6O8S and a molecular weight of 530.30 g/mol. Its IUPAC name is (3R)-3-[[(2R)-2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-3-[[(2R)-2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 147367516 |
| Molecular Formula | C21H23BN6O8S |
| Molecular Weight | 530.30 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | (3R)-3-[[(2R)-2-(2-amino-1,3-thiazol-4-yl)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]acetyl]amino]-2-hydroxy-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | B1([C@H](CC2=C(O1)C(=CC=C2)C(=O)O)NC(=O)[C@@H](C3=CSC(=N3)N)NC(=O)N4CCN(C(=O)C4=O)CC)O |
| InChI | InChI=1S/C21H23BN6O8S/c1-2-27-6-7-28(18(31)17(27)30)21(34)26-14(12-9-37-20(23)24-12)16(29)25-13-8-10-4-3-5-11(19(32)33)15(10)36-22(13)35/h3-5,9,13-14,35H,2,6-8H2,1H3,(H2,23,24)(H,25,29)(H,26,34)(H,32,33)/t13-,14+/m0/s1 |
| InChIKey | DILRTTMELYEDNT-UONOGXRCSA-N |
| XLogP | — |
| TPSA | 233.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | 945 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|