C22H9N5O2 — CID 147368491
12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-7,19-dicarbonitrile (PubChem CID 147368491) has the molecular formula C22H9N5O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is 12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-7,19-dicarbonitrile.
| Compound Name | 12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-7,19-dicarbonitrile |
|---|---|
| PubChem CID | 147368491 |
| Molecular Formula | C22H9N5O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 12,14-dioxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaene-7,19-dicarbonitrile |
| SMILES | N#Cc1ccc2[nH]c3c4[nH]c5ccc(C#N)cc5c4c4c(c3c2c1)C(=O)NC4=O |
| InChI | InChI=1S/C22H9N5O2/c23-7-9-1-3-13-11(5-9)15-17-18(22(29)27-21(17)28)16-12-6-10(8-24)2-4-14(12)26-20(16)19(15)25-13/h1-6,25-26H,(H,27,28,29) |
| InChIKey | DIQHZWMMJUPBGY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|