C11H18O2 — CID 14737053
(8E)-2,9-dimethyl-2,3,4,5,6,7-hexahydrooxecin-10-one (PubChem CID 14737053) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (8E)-2,9-dimethyl-2,3,4,5,6,7-hexahydrooxecin-10-one.
| Compound Name | (8E)-2,9-dimethyl-2,3,4,5,6,7-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 14737053 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (8E)-2,9-dimethyl-2,3,4,5,6,7-hexahydrooxecin-10-one |
| SMILES | C/C1=C\CCCCCC(C)OC1=O |
| InChI | InChI=1S/C11H18O2/c1-9-7-5-3-4-6-8-10(2)13-11(9)12/h7,10H,3-6,8H2,1-2H3/b9-7+ |
| InChIKey | WGJNPYZJJBXAAU-VQHVLOKHSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |