C11H19FO2Si — CID 14737057
(7Z)-8-fluoro-7-trimethylsilyl-3,4,5,6-tetrahydro-2H-oxonin-9-one (PubChem CID 14737057) has the molecular formula C11H19FO2Si and a molecular weight of 230.35 g/mol. Its IUPAC name is (7Z)-8-fluoro-7-trimethylsilyl-3,4,5,6-tetrahydro-2H-oxonin-9-one.
| Compound Name | (7Z)-8-fluoro-7-trimethylsilyl-3,4,5,6-tetrahydro-2H-oxonin-9-one |
|---|---|
| PubChem CID | 14737057 |
| Molecular Formula | C11H19FO2Si |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (7Z)-8-fluoro-7-trimethylsilyl-3,4,5,6-tetrahydro-2H-oxonin-9-one |
| SMILES | C[Si](C)(C)/C1=C(\F)C(=O)OCCCCC1 |
| InChI | InChI=1S/C11H19FO2Si/c1-15(2,3)9-7-5-4-6-8-14-11(13)10(9)12/h4-8H2,1-3H3/b10-9- |
| InChIKey | UACKEEBPJFXUOT-KTKRTIGZSA-N |
| XLogP | 3.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|