About 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene
11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene (PubChem CID 14737390) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene.
Molecular Properties
| Compound Name | 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene |
| PubChem CID | 14737390 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene |
| SMILES | COc1c2cccc1CCCCC2 |
| InChI | InChI=1S/C12H16O/c1-13-12-10-6-3-2-4-7-11(12)9-5-8-10/h5,8-9H,2-4,6-7H2,1H3 |
| InChIKey | PJTMLBMSONXNNZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene?
The IUPAC name of 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene (CID 14737390) is 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene.
What is the SMILES notation for 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene?
The canonical SMILES for 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene is COc1c2cccc1CCCCC2.
What is the InChIKey of 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene?
The InChIKey is PJTMLBMSONXNNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-13-12-10-6-3-2-4-7-11(12)9-5-8-10/h5,8-9H,2-4,6-7H2,1H3.
What are the key properties of 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene?
11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene has a molecular weight of 176.26 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methoxybicyclo[5.3.1]undeca-1(11),7,9-triene is sourced from PubChem (CID 14737390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).