C9H14O2 — CID 14737804
2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-ol (PubChem CID 14737804) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-ol.
| Compound Name | 2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-ol |
|---|---|
| PubChem CID | 14737804 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 2,4-dimethyl-8-oxabicyclo[3.2.1]oct-6-en-3-ol |
| SMILES | CC1C2C=CC(O2)C(C)C1O |
| InChI | InChI=1S/C9H14O2/c1-5-7-3-4-8(11-7)6(2)9(5)10/h3-10H,1-2H3 |
| InChIKey | QCPBKNVOPQAYFS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|