C23H28O4 — CID 147378550
4,6,6-triethyl-3,5-dihydroxy-2-[2-(4-methylphenyl)cyclopropanecarbonyl]cyclohexa-2,4-dien-1-one (PubChem CID 147378550) has the molecular formula C23H28O4 and a molecular weight of 368.47 g/mol. Its IUPAC name is 4,6,6-triethyl-3,5-dihydroxy-2-[2-(4-methylphenyl)cyclopropanecarbonyl]cyclohexa-2,4-dien-1-one.
| Compound Name | 4,6,6-triethyl-3,5-dihydroxy-2-[2-(4-methylphenyl)cyclopropanecarbonyl]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 147378550 |
| Molecular Formula | C23H28O4 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 4,6,6-triethyl-3,5-dihydroxy-2-[2-(4-methylphenyl)cyclopropanecarbonyl]cyclohexa-2,4-dien-1-one |
| SMILES | CCC1=C(O)C(CC)(CC)C(=O)C(C(=O)C2CC2c2ccc(C)cc2)=C1O |
| InChI | InChI=1S/C23H28O4/c1-5-15-19(24)18(22(27)23(6-2,7-3)21(15)26)20(25)17-12-16(17)14-10-8-13(4)9-11-14/h8-11,16-17,24,26H,5-7,12H2,1-4H3 |
| InChIKey | DKMQRXRUZSAKAH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|